CymitQuimica logo

CAS 42290-97-1

:

3-Methyl-1-phenylbutan-1-amine

Description:
3-Methyl-1-phenylbutan-1-amine, also known as a substituted phenylalkylamine, is a chemical compound characterized by its amine functional group and a branched alkyl chain. It features a butane backbone with a methyl group and a phenyl group attached, contributing to its unique structural properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential psychoactive effects, similar to other compounds in the phenethylamine class, and may interact with neurotransmitter systems in the brain. The presence of the amine group makes it basic, allowing it to form salts with acids. Its solubility can vary, often being more soluble in organic solvents than in water. Due to its structural characteristics, 3-Methyl-1-phenylbutan-1-amine may be subject to regulatory scrutiny in various jurisdictions, particularly concerning its potential use in recreational contexts. As with all chemical substances, proper handling and safety precautions are essential when working with this compound.
Formula:C11H17N
InChI:InChI=1/C11H17N/c1-9(2)8-11(12)10-6-4-3-5-7-10/h3-7,9,11H,8,12H2,1-2H3
InChI key:ZTLDKBMTEANJRD-UHFFFAOYSA-N
SMILES:CC(C)CC(c1ccccc1)N
Synonyms:
  • 3-Methyl-1-phenyl-butylamine
  • Benzenemethanamine, Alpha-(2-Methylpropyl)-
  • (1-Phenylbutyl)amine
Found 3 products.