CAS 423-49-4

1H,1H-Perfluoroheptylamine

Description:

1H,1H-Perfluoroheptylamine, with the CAS number 423-49-4, is a perfluorinated compound characterized by a heptylamine structure where all hydrogen atoms are replaced by fluorine atoms. This results in a highly hydrophobic and lipophobic substance, making it resistant to water and oils. The presence of the amine functional group imparts basic properties, allowing it to participate in various chemical reactions, including those typical of amines. Its perfluorinated nature contributes to its thermal stability and chemical inertness, making it suitable for applications in specialized fields such as surfactants, lubricants, and coatings. Additionally, the compound's unique properties may lead to environmental persistence, raising concerns regarding its ecological impact. Overall, 1H,1H-Perfluoroheptylamine exemplifies the characteristics of perfluorinated compounds, combining stability with potential environmental considerations.

Formula: C₇H₄F₁₃N

InChI: InChI=1/C7H4F13N/c8-2(9,1-21)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h1,21H2

SMILES: C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)N

Synonyms:

• Perfluoroheptylamine
• 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptan-1-Amine

1H,1H-Tridecafluoroheptylamine

CAS: 423-49-4

1H,1H-Tridecafluoroheptylamine

Formula: C₇H₄F₁₃N

Purity: 97%

Color and Shape: clear liquid

Molecular weight: 349.09g/mol

Ref: 54-PC4503

1H,1H-Perfluoroheptylamine

Controlled Product

CAS: 423-49-4

Formula: C₇H₄F₁₃N

Color and Shape: Colourless

Molecular weight: 349.093

Ref: TR-P999483

1H,1H-Perfluoroheptylamine

CAS: 423-49-4

Please enquire for more information about 1H,1H-Perfluoroheptylamine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₄F₁₃N

Purity: Min. 95%

Molecular weight: 349.09 g/mol

Ref: 3D-FP78165