CAS 423-60-9
:1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-1-octanesulfonyl chloride
Description:
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-1-octanesulfonyl chloride, with CAS number 423-60-9, is a fluorinated organic compound characterized by its long carbon chain and multiple fluorine substituents. This compound features a sulfonyl chloride functional group, which makes it reactive and useful in various chemical synthesis applications. The presence of numerous fluorine atoms imparts unique properties, such as high thermal stability, low surface energy, and resistance to chemical degradation, making it suitable for use in specialized coatings and surfactants. Additionally, the fluorinated structure contributes to its hydrophobic characteristics, which can enhance performance in applications requiring water repellency. However, due to its potential environmental impact and toxicity, handling and disposal of this compound must be conducted with caution, adhering to safety regulations. Overall, its distinctive chemical properties make it valuable in industrial applications, particularly in the fields of materials science and chemical manufacturing.
Formula:C8ClF17O2S
InChI:InChI=1S/C8ClF17O2S/c9-29(27,28)8(25,26)6(20,21)4(16,17)2(12,13)1(10,11)3(14,15)5(18,19)7(22,23)24
InChI key:InChIKey=FJHZKRYJOILIGD-UHFFFAOYSA-N
SMILES:C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(S(Cl)(=O)=O)(F)F)(F)F)(F)F)(F)F
Synonyms:- 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-1-octanesulfonyl chloride
- 1-Octanesulfonyl Chloride, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-
- 1-Octanesulfonyl chloride, heptadecafluoro-
- Heptadecafluoro-1-octanesulfonyl chloride
- NSC 292152
- Perfluoro-1-octanesulfonyl chloride
- Perfluorooctanesulfonyl chloride
- Perfluorooctylsulfonyl chloride
- 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctane-1-sulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Perfluorooctanesulfonyl Chloride
CAS:Controlled ProductFormula:C8ClF17O2SColor and Shape:NeatMolecular weight:518.58Perfluorooctanesulphonyl Chloride
CAS:Controlled ProductPerfluorooctanesulphonyl Chloride (PFOS) is a chemical that belongs to the class of perfluoroalkyl substances. It is used in the synthesis of tetraethylammonium, peroxide, yields, telomeric, phosphine, cyclic ketone, phosphonium salt, chlorides and olefinic compounds. PFOS also has a number of commercial applications such as in fire-fighting foams and in the manufacture of fluoropolymers. PFOS is harmful to human health when it enters the body because it accumulates in the blood and remains there for years. It may cause low birth weight in newborns and thyroid hormone disruption. It can also cause liver damage in laboratory animals.
Formula:C8ClF17O2SPurity:Min. 95%Molecular weight:518.58 g/molHeptadecafluoro-1-octanesulfonyl chloride
CAS:Formula:C8ClF17O2SColor and Shape:SolidMolecular weight:518.5753


