CAS 423-82-5
:2-[Ethyl[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)sulfonyl]amino]ethyl 2-propenoate
Description:
The chemical substance known as "2-[Ethyl[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)sulfonyl]amino]ethyl 2-propenoate," with the CAS number 423-82-5, is a fluorinated compound characterized by its complex structure, which includes a sulfonamide group and an acrylate moiety. This compound features a long perfluorinated carbon chain, contributing to its unique properties such as hydrophobicity and lipophobicity, making it useful in various applications, including surfactants and coatings. The presence of the sulfonyl group enhances its stability and reactivity, allowing it to participate in polymerization reactions. Additionally, the acrylate functionality provides sites for further chemical modifications, making it versatile in synthetic chemistry. Overall, this compound exemplifies the characteristics of fluorinated organic compounds, including high thermal stability, low surface energy, and potential applications in advanced materials and chemical processes.
Formula:C15H12F17NO4S
InChI:InChI=1S/C15H12F17NO4S/c1-3-7(34)37-6-5-33(4-2)38(35,36)15(31,32)13(26,27)11(22,23)9(18,19)8(16,17)10(20,21)12(24,25)14(28,29)30/h3H,1,4-6H2,2H3
InChI key:InChIKey=ZAZJGBCGMUKZEL-UHFFFAOYSA-N
SMILES:C(C(C(C(S(N(CCOC(C=C)=O)CC)(=O)=O)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 1-Octanesulfonamide, N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(2-hydroxyethyl)-, acrylate
- 1-Octanesulfonamide, N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(2-hydroxyethyl)-, acrylate (ester)
- 2-(Ethyl((heptadecafluorooctyl)sulfonyl)amino)ethyl acrylate
- 2-(N-Ethylperfluorooctanesulfonamido)Ethyl Acrylate
- 2-Propenoic acid, 2-(ethyl((1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)sulfonyl)amino)ethyl ester
- 2-Propenoic acid, 2-(ethyl((heptadecafluorooctyl)sulfonyl)amino)ethyl ester
- 2-[Ethyl[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)sulfonyl]amino]ethyl 2-propenoate
- 2-[N-Ethyl-N-(perfluorooctylsulfonyl)amino]ethyl acrylate
- 2-{Ethyl[(Heptadecafluorooctyl)Sulfonyl]Amino}Ethyl Prop-2-Enoate
- Acrylic acid, ester with N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(2-hydroxyethyl)-1-octanesulfonamide
- Acrylic acid, ester with N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(2-hydroxyethyl)octanesulfonamide
- Fluorad FX 13
- Fx 13
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate
CAS:Controlled Product2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate is a synthetic polymer that forms supramolecular aggregates in water. 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate has viscosity and molecular weight properties similar to those of polyacrylamide, but it is more soluble in water. The polymer concentration can be increased by adding ammonium persulfate, which acts as an initiator for the polymerization process. The polymerization reaction produces beta-cyclodextrin as a byproduct, which is also a supramolecular aggregate. When the polymer concentration exceeds 10 mg/mL, the self-assembly process becomes irreversible and the formation of nanodomains is enhanced. This process can be observed using dynamic light scattering with a constant enhancement factor that is greater than one. The hydrophobic bonds between the monomers are responsible for this phenomenon.Formula:C15H12F17NO4SPurity:Min. 95%Color and Shape:PowderMolecular weight:625.3 g/mol
