CAS 4231-68-9
:1-Phenyl-3-hydroxy-1,2,4-triazole
Description:
1-Phenyl-3-hydroxy-1,2,4-triazole, with the CAS number 4231-68-9, is a heterocyclic organic compound characterized by its triazole ring structure, which contains three nitrogen atoms and two carbon atoms. This compound features a phenyl group attached to the triazole ring, contributing to its aromatic properties. The presence of a hydroxyl group (-OH) at the 3-position of the triazole enhances its solubility in polar solvents and can influence its reactivity and biological activity. 1-Phenyl-3-hydroxy-1,2,4-triazole is known for its potential applications in various fields, including agriculture as a fungicide and in pharmaceuticals for its biological activity. Its chemical stability and ability to form hydrogen bonds due to the hydroxyl group make it a versatile compound in synthetic chemistry. Additionally, the compound's structure allows for various substitution reactions, which can lead to the development of derivatives with tailored properties for specific applications.
Formula:C8H7N3O
InChI:InChI=1/C8H7N3O/c12-8-9-6-11(10-8)7-4-2-1-3-5-7/h1-6H,(H,10,12)
InChI key:InChIKey=QCDMYEHBRNFUQG-UHFFFAOYSA-N
SMILES:O=C1NN(C=N1)C2=CC=CC=C2
Synonyms:- 1,2-Dihydro-1-phenyl-3H-1,2,4-triazol-3-one
- 1-Phenyl-1,2,4-triazol-3-ol
- 1-Phenyl-1,2,4-triazole-3-ol
- 1-Phenyl-1,2-dihydro-3H-1,2,4-triazol-3-one
- 1-Phenyl-1H-1,2,4-triazol-3-ol
- 1H-1,2,4-triazol-3-ol, 1-phenyl-
- 2-Phenyl-1H-1,2,4-triazol-5-one
- 224-187-5
- 3-Hydroxy-1-Phenyl-1,2,4-Triazole
- 3-Hydroxy-1-phenyl-1,2,4-1H-triazole
- 3-Hydroxy-1-phenyl-1H-1,2,4-triazole
- 3H-1,2,4-Triazol-3-one, 1,2-dihydro-1-phenyl-
- Δ<sup>3</sup>-1,2,4-Triazolin-5-one, 2-phenyl-
- Δ3-1,2,4-Triazolin-5-one, 2-phenyl-
- 1-Phenyl-3-hydroxy-1,2,4-triazole
- 1-Phenyl-2H-1,2,4-triazol-3-one
- 1-Phenyl-1H-1,2,4-triazole-3-ol
- 1-Phenyl-3-hydroxy-1H-1,2,4-triazole
- BUTTPARK 62\07-51
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Phenyl-1H-1,2,4-triazol-3(2H)-one
CAS:Formula:C8H7N3OPurity:98%Color and Shape:SolidMolecular weight:161.16073-Hydroxy-1-phenyl-1H-1,2,4-triazole
CAS:3-Hydroxy-1-phenyl-1H-1,2,4-triazoleFormula:C8H7N3OPurity:98%Color and Shape:SolidMolecular weight:161.16g/mol1-Phenyl-1,2,4-triazol-3-ol
CAS:Formula:C8H7N3OPurity:95.0%Color and Shape:SolidMolecular weight:161.1641-Phenyl-3-hydroxy-1,2,4-triazole
CAS:1-Phenyl-3-hydroxy-1,2,4-triazole is a potentiodynamic polarization inhibitor. It is used as a corrosion inhibitor in wastewater treatment and is also used as an antimicrobial agent in microbiological culture. 1-Phenyl-3-hydroxy-1,2,4-triazole inhibits the growth of microorganisms by regulating the metabolism of the cell membrane potential. It has been shown to be effective against Chlorpyrifos and other pesticides that are resistant to irradiation. This compound can be synthesized by electrochemical methods or physicochemical methods such as chlorination or photolysis.
Formula:C8H7N3OPurity:Min. 95%Color and Shape:PowderMolecular weight:161.16 g/molRef: 3D-FP149150
Discontinued product



