CAS 423116-18-1

2-[(4-oxocyclohexyl)methyl]-1H-isoindole-1,3(2H)-dione

Description:

2-[(4-oxocyclohexyl)methyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 423116-18-1, is a synthetic organic compound characterized by its isoindole structure, which features a fused ring system comprising a benzene and a five-membered nitrogen-containing ring. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural properties. The presence of the 4-oxocyclohexyl group suggests that it may have interesting steric and electronic characteristics, influencing its reactivity and biological activity. The compound may also display specific solubility properties, depending on the solvent used, and can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its stability and reactivity can be influenced by factors such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, and its environmental impact should be assessed in accordance with regulatory guidelines.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1/C15H15NO3/c17-11-7-5-10(6-8-11)9-16-14(18)12-3-1-2-4-13(12)15(16)19/h1-4,10H,5-9H2

SMILES: c1ccc2c(c1)C(=O)N(CC1CCC(=O)CC1)C2=O

Synonyms:

• 1H-Isoindole-1,3(2H)-dione, 2-[(4-oxocyclohexyl)methyl]-

2-(4-Oxocyclohexylmethyl)isoindole-1,3-dione

CAS: 423116-18-1

Formula: C₁₅H₁₅NO₃

Purity: 95%

Molecular weight: 257.2845

Ref: IN-DA00BZQH