CAS 423165-33-7
:2-Bromo-4-nitrophenetole
Description:
2-Bromo-4-nitrophenetole is an organic compound characterized by the presence of a bromine atom and a nitro group attached to a phenolic structure. It features a phenol ring substituted at the 2-position with a bromine atom and at the 4-position with a nitro group, which influences its chemical reactivity and properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring. The presence of the nitro group introduces electron-withdrawing characteristics, which can affect the acidity of the hydroxyl group and the overall reactivity of the compound in electrophilic aromatic substitution reactions. Additionally, 2-Bromo-4-nitrophenetole may exhibit biological activity, making it of interest in medicinal chemistry and material science. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Proper handling and disposal procedures are essential when working with this substance in a laboratory setting.
Formula:C8H8BrNO3
InChI:InChI=1/C8H8BrNO3/c1-2-13-8-5-6(10(11)12)3-4-7(8)9/h3-5H,2H2,1H3
SMILES:CCOc1cc(ccc1Br)N(=O)=O
Synonyms:- 1-Bromo-2-ethoxy-4-nitrobenzene
- 2-Bromo-5-nitrophenetole
- 2-Bromo-5-nitrophenyl ethyl ether
- 423165-33-7
- Benzene, 1-bromo-2-ethoxy-4-nitro-
- Wnr De Co2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-2-ethoxy-4-nitrobenzene
CAS:Formula:C8H8BrNO3Purity:97%Color and Shape:SolidMolecular weight:246.05801-Bromo-2-ethoxy-4-nitrobenzene
CAS:1-Bromo-2-ethoxy-4-nitrobenzenePurity:98%Molecular weight:246.06g/mol2-Bromo-5-nitrophenetole
CAS:2-Bromo-5-nitrophenetole is a versatile building block that can be used as a reagent in the synthesis of complex compounds and research chemicals. It is a high quality chemical with a CAS number of 423165-33-7. 2-Bromo-5-nitrophenetole is an important intermediate for the synthesis of diverse and valuable compounds such as pharmaceuticals, agrochemicals, and dyes.Formula:C8H8BrNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:246.06 g/mol



