CAS 42327-95-7

2,2-dimethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid

Description:

2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid is an organic compound characterized by its unique bicyclic structure, which includes a benzofuran moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of two methyl groups at the 2-position enhances its steric bulk and may influence its reactivity and solubility. Typically, compounds like this can exhibit moderate to low solubility in water, depending on the specific interactions of the functional groups with the solvent. The bicyclic structure can also impart interesting chemical properties, such as potential reactivity in electrophilic aromatic substitution or other organic transformations. Additionally, the compound may have applications in pharmaceuticals or as a building block in organic synthesis due to its structural features. Safety and handling precautions should be observed, as with any chemical substance, particularly when dealing with carboxylic acids, which can be corrosive. Overall, 2,2-dimethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid is a compound of interest in organic chemistry for its structural and functional characteristics.

Formula: C₁₁H₁₂O₃

InChI: InChI=1/C11H12O3/c1-11(2)6-7-4-3-5-8(10(12)13)9(7)14-11/h3-5H,6H2,1-2H3,(H,12,13)

SMILES: CC1(C)Cc2cccc(c2O1)C(=O)O

2,2-DIMETHYL-2,3-DIHYDRO-1-BENZOFURAN-7-CARBOXYLIC ACID

CAS: 42327-95-7

Formula: C₁₁H₁₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 192.2112

Ref: IN-DA00C8NZ

2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid

CAS: 42327-95-7

Purity: 95+%

Molecular weight: 192.2140045

Ref: 10-F639799

2,2-dimethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid

CAS: 42327-95-7

2,2-dimethyl-2,3-dihydrobenzofuran-7-carboxylic acid can be synthesized from formic acid and phenol. The esterification of formic acid with phenol in the presence of a strong base yields 2,2-dimethyl-2,3-dihydrobenzofuran-7-carboxylic acid. This synthesis proceeds via an alkoxy group and requires high yield conditions. The product can be used as an intermediate for amides or as a reflux solvent. 2,2-dimethylbenzofuran is a trifluoromethyl compound that reacts with formic acid to produce 2,2-dimethyl-2,3-dihydrobenzofuran.

Formula: C₁₁H₁₂O₃

Purity: Min. 95%

Molecular weight: 192.21 g/mol

Ref: 3D-SBA32795