CAS 42329-17-9

3H-Oxazolo[3,4-a]pyridin-3-one, hexahydro-

Description:

3H-Oxazolo[3,4-a]pyridin-3-one, hexahydro- is a heterocyclic organic compound characterized by its fused oxazole and pyridine rings. This compound features a hexahydro structure, indicating that it contains a saturated ring system, which contributes to its stability and potential reactivity. The presence of the oxazole moiety suggests that it may exhibit biological activity, as many oxazole derivatives are known for their pharmacological properties. The compound's molecular structure includes nitrogen and oxygen atoms, which can participate in hydrogen bonding and influence its solubility and interaction with biological targets. Its CAS number, 42329-17-9, allows for easy identification in chemical databases. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this type often exhibit moderate to high polarity, affecting their behavior in various chemical environments. Overall, 3H-Oxazolo[3,4-a]pyridin-3-one, hexahydro- represents a class of compounds with potential applications in medicinal chemistry and materials science.

Formula: C₇H₁₁NO₂

InChI: InChI=1S/C7H11NO2/c9-7-8-4-2-1-3-6(8)5-10-7/h6H,1-5H2

InChI key: InChIKey=OFJXJWVJNKEUCV-UHFFFAOYSA-N

SMILES: O=C1N2C(CCCC2)CO1

Synonyms:

• 3H-Oxazolo[3,4-a]pyridin-3-one, hexahydro-
• 1,5,6,7,8,8a-Hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one
• Hexahydro-3H-oxazolo[3,4-a]pyridin-3-one

Pipecolic Acid Impurity 1

CAS: 42329-17-9

Formula: C₇H₁₁NO₂

Molecular weight: 141.17

Ref: 4Z-P-246011