CAS 4234-79-1
:Kelevan
Description:
Kelevan, with the CAS number 4234-79-1, is a chemical compound known for its application as a pharmaceutical agent. It is characterized by its specific molecular structure, which contributes to its biological activity. Typically, compounds like Kelevan exhibit properties such as solubility in various solvents, stability under certain conditions, and a defined melting or boiling point. Its interactions with biological systems often involve mechanisms such as enzyme inhibition or receptor binding, making it relevant in medicinal chemistry. Additionally, safety data sheets would provide information on its toxicity, handling precautions, and environmental impact. As with many chemical substances, understanding its characteristics is crucial for its effective and safe use in research and therapeutic applications. For detailed information regarding its specific properties, including spectral data or reactivity, consulting specialized chemical databases or literature is recommended.
Formula:C17H12Cl10O4
InChI:InChI=1S/C17H12Cl10O4/c1-2-31-7(29)4-3-6(28)5-8(30)9(18)11(20)13(22)10(8,19)14(23)12(9,21)15(11,24)17(26,27)16(13,14)25/h30H,2-5H2,1H3
InChI key:InChIKey=POSKOXIJDWDKPH-UHFFFAOYSA-N
SMILES:ClC12C3(Cl)C4(Cl)C(CC(CCC(OCC)=O)=O)(O)C1(Cl)C5(Cl)C2(Cl)C(Cl)(Cl)C3(Cl)C45Cl
Synonyms:- 1,3,4-Metheno-1H-cyclobuta[cd]pentalene-2-levulinic acid, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro-2-hydroxy-, ethyl ester
- 1,3,4-Metheno-1H-cyclobuta[cd]pentalene-2-pentanoic acid, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro-2-hydroxy-γ-oxo-, ethyl ester
- Allied GC 9160
- Despirol
- Ethyl 1,1a,3,3a,4,5,5a,5b,6-decachlorooctahydro-2-hydroxy-1,3,4-metheno-1H-cyclobuta[cd]pentalene-2-levulinate
- Gc 9160
- General Chemical 9160
- General Chemicals 9160
- ethyl 5-(1,2,3,5,6,7,8,9,10,10-decachloro-4-hydroxypentacyclo(5.2.1.O2,6.O3,9.O5,8)dec-4-yl)-4-oxovalerate
- ethyl 5-[1,1a,3,3a,4,5,5,5a,5b,6-decachloro-2-hydroxyoctahydro-1H-1,3,4-(methanetriyl)cyclobuta[cd]pentalen-2-yl]-4-oxopentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Kelevan
CAS:Kelevan is an insecticide.Formula:C17H12Cl10O4Color and Shape:SolidMolecular weight:634.80Kelevan
CAS:Controlled ProductApplications Keleva
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C17H12Cl10O4Color and Shape:WhiteMolecular weight:634.8


