
CAS 42365-55-9
:Benzenemethanamine, 2-chloro-5-methyl-, hydrochloride (1:1)
Description:
Benzenemethanamine, 2-chloro-5-methyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine functional group and aromatic structure. The presence of a chlorine atom and a methyl group on the benzene ring contributes to its unique reactivity and properties. This compound typically appears as a white crystalline solid and is soluble in water due to the hydrochloride form, which enhances its ionic character. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The amine group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Proper storage conditions are essential to maintain its stability and prevent degradation. As with any chemical, appropriate safety measures should be taken when handling this substance in a laboratory or industrial setting.
Formula:C8H10ClN·ClH
InChI:InChI=1S/C8H10ClN.ClH/c1-6-2-3-8(9)7(4-6)5-10;/h2-4H,5,10H2,1H3;1H
InChI key:InChIKey=JVENPKHXJGHJHB-UHFFFAOYSA-N
SMILES:C(N)C1=C(Cl)C=CC(C)=C1.Cl
Synonyms:- Benzenemethanamine, 2-chloro-5-methyl-, hydrochloride
- Benzenemethanamine, 2-chloro-5-methyl-, hydrochloride (1:1)
- (2-Chloro-5-methylphenyl)methanamine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2-Chloro-5-methylphenyl)methanamine hydrochloride
CAS:Formula:C8H11Cl2NPurity:95+%Color and Shape:SolidMolecular weight:192.08562-Chloro-5-methylbenzylamine hydrochloride
CAS:2-Chloro-5-methylbenzylamine hydrochloride is a chemical that is used as a versatile building block in the synthesis of complex compounds. It has a wide range of uses, including as a research chemical, reagent, and speciality chemical. 2-Chloro-5-methylbenzylamine hydrochloride is also used as an intermediate in the synthesis of other chemicals and can be used as an organic building block, reaction component, and scaffold. This product can be used to produce high-quality products, such as pharmaceuticals and agrochemicals.Formula:C8H10ClN•HClPurity:Min. 95%Molecular weight:192.09 g/mol


