CAS 42365-60-6

Benzenemethanamine, 2-chloro-4-fluoro-, hydrochloride (1:1)

Description:

Benzenemethanamine, 2-chloro-4-fluoro-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is an organic compound characterized by its amine functional group and aromatic benzene ring. The presence of chlorine and fluorine substituents on the benzene ring significantly influences its chemical properties, including reactivity and polarity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry for potential therapeutic uses. Its molecular structure suggests that it could participate in hydrogen bonding due to the amine group, affecting its interaction with biological targets. Additionally, the specific arrangement of substituents can impact its electronic properties, influencing its behavior in chemical reactions. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper safety measures are in place.

Formula: C₇H₇ClFN·ClH

InChI: InChI=1S/C7H7ClFN.ClH/c8-7-3-6(9)2-1-5(7)4-10;/h1-3H,4,10H2;1H

InChI key: InChIKey=JRLSDBJQSHLCRS-UHFFFAOYSA-N

SMILES: C(N)C1=C(Cl)C=C(F)C=C1.Cl

Synonyms:

• Benzenemethanamine, 2-chloro-4-fluoro-, hydrochloride
• 2-Chloro-4-fluorobenzylamine hydrochloride
• Benzenemethanamine, 2-chloro-4-fluoro-, hydrochloride (1:1)

2-Chloro-4-fluorobenzylamine hydrochloride

CAS: 42365-60-6

2-Chloro-4-fluorobenzylamine hydrochloride

Purity: ≥95%

Molecular weight: 196.05g/mol

Ref: 54-PC8148