CAS 42365-62-8

1-[3,5-bis(trifluoromethyl)phenyl]methanamine hydrochloride (1:1)

Description:

1-[3,5-bis(trifluoromethyl)phenyl]methanamine hydrochloride (1:1), with the CAS number 42365-62-8, is a chemical compound characterized by its unique structure, which includes a methanamine group attached to a phenyl ring that is further substituted with two trifluoromethyl groups at the 3 and 5 positions. This substitution significantly enhances the compound's lipophilicity and alters its electronic properties, making it of interest in various chemical and pharmaceutical applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for formulation in biological studies. The presence of trifluoromethyl groups often imparts unique reactivity and stability, influencing the compound's behavior in chemical reactions and interactions with biological systems. Additionally, the compound may exhibit specific pharmacological properties, making it a candidate for research in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with trifluoromethylated compounds.

Formula: C₉H₈ClF₆N

InChI: InChI=1/C9H7F6N.ClH/c10-8(11,12)6-1-5(4-16)2-7(3-6)9(13,14)15;/h1-3H,4,16H2;1H

SMILES: c1c(cc(cc1C(F)(F)F)C(F)(F)F)CN.Cl

Synonyms:

• 1-[3,5-Bis(trifluoromethyl)phenyl]methanamine hydrochloride
• 3,5-Bis(Trifluoromethyl)Benzylaminehydrochloride

3,5-Bis(trifluoromethyl)benzylamine, HCl

CAS: 42365-62-8

Formula: C₉H₈ClF₆N

Purity: 95%

Molecular weight: 279.6099

Ref: IN-DA0072ME

(3,5-Bis(Trifluoromethyl)Phenyl)Methanamine Hydrochloride

CAS: 42365-62-8

(3,5-Bis(Trifluoromethyl)Phenyl)Methanamine Hydrochloride

Purity: 98%

Molecular weight: 279.61g/mol

Ref: 54-PC108548

3,5-Bis(trifluoromethyl)benzylaminehydrochloride

CAS: 42365-62-8

Formula: C₉H₈ClF₆N

Purity: 95%

Color and Shape: Solid

Molecular weight: 279.61

Ref: 10-F041106