CAS 423730-14-7

4-{[(5-methylfuran-3-yl)carbonyl]amino}benzoic acid

Description:

4-{[(5-methylfuran-3-yl)carbonyl]amino}benzoic acid, with the CAS number 423730-14-7, is an organic compound characterized by its unique structure that includes both a benzoic acid moiety and a 5-methylfuran group. This compound features an amine linkage, where the amino group is attached to the benzoic acid, and a carbonyl group derived from the furan ring. The presence of the furan ring contributes to its aromatic properties and potential reactivity. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid functional group, while the furan and aromatic components may enhance its lipophilicity. It may also display interesting biological activities, making it a candidate for pharmaceutical applications. The specific interactions and stability of this compound can be influenced by factors such as pH and temperature, which are critical for its potential use in various chemical and biological contexts.

Formula: C₁₃H₁₁NO₄

InChI: InChI=1/C13H11NO4/c1-8-6-10(7-18-8)12(15)14-11-4-2-9(3-5-11)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)

SMILES: Cc1cc(co1)C(=O)Nc1ccc(cc1)C(=O)O

Synonyms:

• Benzoic Acid, 4-[[(5-Methyl-3-Furanyl)Carbonyl]Amino]-

4-[(5-methyl-3-furoyl)amino]benzoic acid

CAS: 423730-14-7

Formula: C₁₃H₁₁NO₄

Purity: 95.0%

Molecular weight: 245.234

Ref: 10-F314646