CAS 423731-96-8

4-{[(5-methylfuran-2-yl)carbonyl]amino}benzoic acid

Description:

4-{[(5-methylfuran-2-yl)carbonyl]amino}benzoic acid, identified by its CAS number 423731-96-8, is an organic compound characterized by its complex structure that includes both an amino group and a carboxylic acid group, making it an amino acid derivative. The presence of the 5-methylfuran moiety contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound is likely to exhibit polar characteristics due to the functional groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or as a biochemical probe, given the furan ring's role in various biological activities. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The stability and reactivity of this substance can be influenced by environmental factors such as pH and temperature, which are crucial for its handling and application in research or industrial settings. Overall, 4-{[(5-methylfuran-2-yl)carbonyl]amino}benzoic acid represents a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₁₃H₁₁NO₄

InChI: InChI=1/C13H11NO4/c1-8-2-7-11(18-8)12(15)14-10-5-3-9(4-6-10)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)

SMILES: Cc1ccc(C(=Nc2ccc(cc2)C(=O)O)O)o1

Synonyms:

• 4-[(5-Methyl-2-furoyl)amino]benzoic acid
• Benzoic acid, 4-[[(5-methyl-2-furanyl)carbonyl]amino]-

4-[(5-methyl-2-furoyl)amino]benzoic acid

CAS: 423731-96-8

Formula: C₁₃H₁₁NO₄

Purity: 95.0%

Molecular weight: 245.234

Ref: 10-F314636