CAS 423741-70-2
:5-(2-methylphenyl)-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol
Description:
5-(2-Methylphenyl)-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a thiol group (-SH) that contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the 2-methylphenyl and prop-2-en-1-yl substituents enhances its molecular diversity, potentially influencing its biological activity and solubility. The compound's structure suggests it may exhibit properties such as antioxidant activity or serve as a ligand in coordination chemistry. Additionally, the triazole moiety is known for its role in medicinal chemistry, particularly in the development of antifungal and antibacterial agents. As with many thiol-containing compounds, it may also participate in redox reactions, making it of interest in biochemical studies. Overall, this compound's unique structural features position it as a candidate for further research and application in various scientific domains.
Formula:C12H13N3S
InChI:InChI=1/C12H13N3S/c1-3-8-15-11(13-14-12(15)16)10-7-5-4-6-9(10)2/h3-7H,1,8H2,2H3,(H,14,16)
SMILES:C=CCn1c(c2ccccc2C)nnc1S
Synonyms:- 4-Allyl-5-(2-methylphenyl)-4H-1,2,4-triazole-3-thiol
- 4H-1,2,4-triazole-3-thiol, 5-(2-methylphenyl)-4-(2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
