CAS 423751-80-8

2-[5-(3-bromophenyl)-1H-pyrazol-3-yl]phenol

Description:

2-[5-(3-bromophenyl)-1H-pyrazol-3-yl]phenol, with the CAS number 423751-80-8, is an organic compound characterized by its complex structure, which includes a phenolic group and a pyrazole moiety. This compound features a brominated phenyl group, which enhances its reactivity and potential biological activity. The presence of the pyrazole ring contributes to its stability and may impart specific pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water, which is common for many organic compounds with large aromatic systems. Its synthesis often involves multi-step reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, this compound represents a class of molecules that are of interest in both synthetic and medicinal chemistry.

Formula: C₁₅H₁₁BrN₂O

InChI: InChI=1/C15H11BrN2O/c16-11-5-3-4-10(8-11)13-9-14(18-17-13)12-6-1-2-7-15(12)19/h1-9,19H,(H,17,18)

SMILES: c1ccc(c(c1)c1cc(c2cccc(c2)Br)[nH]n1)O

Synonyms:

• 2-[5-(3-Bromo-phenyl)-1H-pyrazol-3-yl]-phenol

2-[5-(3-bromophenyl)-1H-pyrazol-3-yl]phenol

CAS: 423751-80-8

Purity: 95.0%

Molecular weight: 315.1700134277344

Ref: 10-F314704