CAS 423768-36-9

[5-(2-pyridinyl)-2-thienyl]methylamine dihydrochloride

Description:

[5-(2-pyridinyl)-2-thienyl]methylamine dihydrochloride is a chemical compound characterized by its unique structure, which includes a thienyl group and a pyridinyl moiety. This compound is typically a white to off-white crystalline solid, indicating its potential stability and purity in solid form. It is soluble in water and other polar solvents, which is common for dihydrochloride salts due to the presence of multiple hydrochloride groups that enhance solubility. The presence of both the pyridine and thienyl rings suggests potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as being a ligand for various biological targets, and its amine functional group can participate in hydrogen bonding, influencing its reactivity and interactions. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, this compound's structural features suggest it may have applications in medicinal chemistry and related fields.

Formula: C₁₀H₁₂Cl₂N₂S

InChI: InChI=1/C10H10N2S.2ClH/c11-7-8-4-5-10(13-8)9-3-1-2-6-12-9;;/h1-6H,7,11H2;2*1H

SMILES: c1ccnc(c1)c1ccc(CN)s1.Cl.Cl

Synonyms:

• 1-(5-Pyridin-2-Ylthiophen-2-Yl)Methanamine Dihydrochloride

1-[5-(Pyridin-2-yl)thien-2-yl]methylamine dihydrochloride

CAS: 423768-36-9

1-[5-(Pyridin-2-yl)thien-2-yl]methylamine dihydrochloride

Purity: 97%

Molecular weight: 263.19g/mol

Ref: 54-OR23037