CAS 423768-45-0

ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate

Description:

Ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate is a chemical compound characterized by its unique structural features, which include a thiazole ring and a thienyl group, along with a carboxylate ester functional group. The presence of the bromine atom enhances its reactivity and may influence its biological activity. This compound is typically a solid at room temperature and is soluble in organic solvents, making it suitable for various synthetic applications. Its thiazole and thienyl components suggest potential applications in pharmaceuticals, particularly in the development of biologically active molecules. The compound may exhibit interesting properties such as antimicrobial or antifungal activity, which is common among thiazole derivatives. Additionally, the ethyl ester group can be hydrolyzed to yield the corresponding acid, allowing for further functionalization. As with many synthetic organic compounds, handling should be done with care, following appropriate safety protocols due to potential toxicity or reactivity.

Formula: C₁₀H₈BrNO₂S₂

InChI: InChI=1/C10H8BrNO2S2/c1-2-14-10(13)6-5-15-9(12-6)7-3-4-8(11)16-7/h3-5H,2H2,1H3

SMILES: CCOC(=O)c1csc(c2ccc(Br)s2)n1

Synonyms:

• Ethyl 2-(5-Bromothiophen-2-Yl)-1,3-Thiazole-4-Carboxylate

ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate

CAS: 423768-45-0

ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate

Purity: 94%

Color and Shape: Solid

Molecular weight: 318.21g/mol

Ref: 54-OR25943