CAS 423768-60-9

4-(1,3-dioxolan-2-yl)piperidine oxalate

Description:

4-(1,3-Dioxolan-2-yl)piperidine oxalate is a chemical compound characterized by its unique structural features, which include a piperidine ring and a dioxolane moiety. The presence of the dioxolane ring contributes to its potential solubility in polar solvents, while the piperidine structure may impart basic properties. As an oxalate salt, it is formed from the reaction of oxalic acid with the corresponding piperidine derivative, which can influence its stability and reactivity. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular interactions could be influenced by the functional groups present, allowing for potential applications in various fields, including pharmaceuticals. The compound's properties, such as melting point, solubility, and reactivity, would typically be determined through experimental methods, and its safety profile would need to be assessed for any potential hazards associated with handling or exposure. Overall, 4-(1,3-dioxolan-2-yl)piperidine oxalate represents a versatile structure with potential applications in chemical and biological research.

Formula: C₁₃H₂₃NO₆

InChI: InChI=1/C11H21NO2.C2H2O4/c1-11(2)7-13-10(14-8-11)9-3-5-12-6-4-9;3-1(4)2(5)6/h9-10,12H,3-8H2,1-2H3;(H,3,4)(H,5,6)

SMILES: CC1(C)COC(C2CCNCC2)OC1.C(=O)(C(=O)O)O

Synonyms:

• 4-(1,3-Dioxolan-2-yl)piperidine
• 4-(5,5-Dimethyl-1,3-Dioxan-2-Yl)Piperidine Ethanedioate

4-(5,5-dimethyl-1,3-dioxan-2-yl)piperidine oxalate

CAS: 423768-60-9

4-(5,5-dimethyl-1,3-dioxan-2-yl)piperidine oxalate

Purity: ≥95%

Molecular weight: 289.32g/mol

Ref: 54-OR25960