CAS 42389-50-4
:N,N-Dimethylcyclohexane-1,4-diamine
Description:
N,N-Dimethylcyclohexane-1,4-diamine, with the CAS number 42389-50-4, is an organic compound characterized by its cyclic structure and the presence of two amine functional groups. This compound features a cyclohexane ring substituted with two methyl groups and two amine groups located at the 1 and 4 positions of the ring. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of amine groups imparts basicity and nucleophilicity to the molecule, making it reactive in various chemical reactions, such as alkylation and acylation. N,N-Dimethylcyclohexane-1,4-diamine is often used in the synthesis of polymers, resins, and as a curing agent in epoxy formulations. Its physical properties, such as boiling point and solubility, can vary based on the specific isomer and conditions. Safety precautions are necessary when handling this compound, as it may cause irritation to the skin and eyes, and proper storage conditions should be maintained to ensure stability.
Formula:C8H18N2
InChI:InChI=1/C8H18N2/c1-10(2)8-5-3-7(9)4-6-8/h7-8H,3-6,9H2,1-2H3
SMILES:CN(C)C1CCC(CC1)N
Synonyms:- 1,4-cyclohexanediamine, N~1~,N~1~-dimethyl-
- N1,N1-Dimethyl-1,4-cyclohexanediamine 2HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N,N-Dimethyl-1,4-cyclohexanediamine (cis- and trans- mixture)
CAS:Formula:C8H18N2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Yellow clear liquidMolecular weight:142.25N,N-Dimethylcyclohexane-1,4-diamine
CAS:Formula:C8H18N2Purity:97%Color and Shape:LiquidMolecular weight:142.2419N,N-Dimethylcyclohexane-1,4-diamine
CAS:N,N-Dimethylcyclohexane-1,4-diaminePurity:95%Molecular weight:142.24g/molN1,N1-Dimethylcyclohexane-1,4-diamine
CAS:Formula:C8H18N2Purity:97%Color and Shape:Liquid, No data available.Molecular weight:142.246N,N-Dimethyl-cyclohexane-1,4-diamine
CAS:<p>Please enquire for more information about N,N-Dimethyl-cyclohexane-1,4-diamine including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C8H18N2Purity:Min. 95%Molecular weight:142.24 g/mol




