CAS 42392-68-7
:1,3-Diethyl 2-cyclopropylpropanedioate
Description:
1,3-Diethyl 2-cyclopropylpropanedioate, with the CAS number 42392-68-7, is an organic compound characterized by its diester functional groups. It features a cyclopropyl group attached to a propanedioate backbone, which contributes to its unique structural properties. The presence of ethyl groups enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound is typically a colorless to pale yellow liquid and may exhibit a pleasant odor. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the cyclopropyl moiety can impart interesting reactivity and stability properties, making it a subject of interest in various chemical reactions. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled. Overall, 1,3-Diethyl 2-cyclopropylpropanedioate is a versatile compound with potential utility in multiple chemical applications.
Formula:C10H16O4
InChI:InChI=1S/C10H16O4/c1-3-13-9(11)8(7-5-6-7)10(12)14-4-2/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=YWONUDUUMCJFPN-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C(OCC)=O)C1CC1
Synonyms:- Propanedioic acid, 2-cyclopropyl-, 1,3-diethyl ester
- Diethyl 2-cyclopropylmalonate
- Diethyl cyclopropylmalonate
- Propanedioic acid, cyclopropyl-, diethyl ester
- 1,3-Diethyl 2-cyclopropylpropanedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
diethyl 2-cyclopropylpropanedioate
CAS:Formula:C10H16O4Purity:95%Color and Shape:LiquidMolecular weight:200.2316Diethyl 2-cyclopropylmalonate
CAS:Diethyl 2-cyclopropylmalonate
Purity:97%Molecular weight:200.234g/moldiethyl 2-cyclopropylpropanedioate
CAS:Diethyl 2-cyclopropylpropanedioate is a nitro-containing compound that is used as an insecticide. It has been shown to have a synergistic effect when combined with cyhalothrin, but it is ineffective against some insects, such as mosquitoes. Diethyl 2-cyclopropylpropanedioate is also a chrysanthemic acid derivative that can be synthesized through the reaction of methoxymethyl chloride and chloroacetone. The stereoisomers of this compound are useful for determining the structure of chrysanthemic acid. Diethyl 2-cyclopropylpropanedioate has no known biological activity in humans.
Formula:C10H16O4Purity:Min. 95%Molecular weight:200.23 g/mol



