CymitQuimica logo

CAS 42399-50-8

:

(αR,βR)-β-[(2-Aminophenyl)thio]-α-hydroxy-4-methoxybenzenepropanoic acid

Description:
The chemical substance known as (αR,βR)-β-[(2-Aminophenyl)thio]-α-hydroxy-4-methoxybenzenepropanoic acid, with the CAS number 42399-50-8, is characterized by its complex molecular structure, which includes an amino group, a thioether linkage, and a methoxy group. This compound is likely to exhibit both hydrophilic and hydrophobic properties due to the presence of polar functional groups (such as the amino and hydroxyl groups) and non-polar components (like the methoxy group). Its stereochemistry, indicated by the (αR,βR) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with other molecules. The presence of the thioether group may also impart unique reactivity and stability characteristics. This compound could potentially be of interest in pharmaceutical applications, particularly in the development of drugs targeting specific biological pathways, given its structural features that may interact with biological receptors or enzymes. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C16H17NO4S
InChI:InChI=1S/C16H17NO4S/c1-21-11-8-6-10(7-9-11)15(14(18)16(19)20)22-13-5-3-2-4-12(13)17/h2-9,14-15,18H,17H2,1H3,(H,19,20)/t14-,15+/m0/s1
InChI key:InChIKey=KHQWPNQLSKDWAR-LSDHHAIUSA-N
SMILES:[C@H](SC1=C(N)C=CC=C1)([C@@H](C(O)=O)O)C2=CC=C(OC)C=C2
Synonyms:
  • Benzenepropanoic acid, β-[(2-aminophenyl)thio]-α-hydroxy-4-methoxy-, [R-(R*,R*)]-
  • (-)-threo-2-Hydroxy-3-(2-aminophenylthio)-3-(4-methoxyphenyl)propionic acid
  • Benzenepropanoic acid, β-[(2-aminophenyl)thio]-α-hydroxy-4-methoxy-, (αR,βR)-
  • (αR,βR)-β-[(2-Aminophenyl)thio]-α-hydroxy-4-methoxybenzenepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.