CAS 424-40-8
:1,5-Diethyl 2,2,3,3,4,4-hexafluoropentanedioate
Description:
1,5-Diethyl 2,2,3,3,4,4-hexafluoropentanedioate, with the CAS number 424-40-8, is a fluorinated organic compound characterized by its unique structure that includes two ethyl groups and multiple fluorine atoms attached to a pentanedioate backbone. This compound typically exhibits high thermal stability and low volatility due to the presence of fluorine, which enhances its resistance to degradation. The fluorinated groups contribute to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. Additionally, the presence of the diethyl ester functional groups imparts certain reactivity, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitutions. Its unique properties make it of interest in fields such as materials science and pharmaceuticals, where fluorinated compounds often exhibit enhanced biological activity or improved material characteristics. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.
Formula:C9H10F6O4
InChI:InChI=1S/C9H10F6O4/c1-3-18-5(16)7(10,11)9(14,15)8(12,13)6(17)19-4-2/h3-4H2,1-2H3
InChI key:InChIKey=MSDPXVBLFJODJO-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)(F)F)(C(C(OCC)=O)(F)F)(F)F
Synonyms:- 1,5-Diethyl 2,2,3,3,4,4-hexafluoropentanedioate
- Diethyl Hexafluoropentanedioate
- Diethyl perfluoroglutarate
- Glutaric acid, hexafluoro-, diethyl ester
- Hexafluoroglutaric acid diethyl ester
- NSC 63360
- Pentanedioic acid, 2,2,3,3,4,4-hexafluoro-, 1,5-diethyl ester
- Pentanedioic acid, hexafluoro-, diethyl ester
- Diethyl hexafluoroglutarate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Diethyl 2,2,3,3,4,4-Hexafluoropentanedioate
CAS:Formula:C9H10F6O4Purity:>98.0%(GC)Color and Shape:Light orange to Yellow to Green clear liquidMolecular weight:296.17Diethyl hexafluoroglutarate, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H10F6O4Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:296.16Diethyl hexafluoroglutarate
CAS:Formula:C9H10F6O4Purity:98%Color and Shape:LiquidMolecular weight:296.1637Diethyl perfluoroglutarate
CAS:Diethyl perfluoroglutarateFormula:C9H10F6O4Purity:98%Color and Shape: clear liquidMolecular weight:296.16g/molDiethyl hexafluoroglutarate
CAS:Formula:C9H10F6O4Purity:≥98%(GC)Color and Shape:LiquidMolecular weight:296.165




