CAS 42404-23-9

2-[(4-methylphenyl)sulfanyl]ethanaminium

Description:

2-[(4-Methylphenyl)sulfanyl]ethanaminium, with the CAS number 42404-23-9, is an organic compound characterized by its quaternary ammonium structure. It features a sulfur atom bonded to a phenyl group that has a methyl substituent, indicating the presence of a thioether functional group. The compound is likely to exhibit properties typical of ammonium salts, such as solubility in polar solvents and potential ionic character due to the positively charged nitrogen atom. Its structure suggests it may have applications in various fields, including pharmaceuticals and materials science, due to the presence of both aromatic and sulfur-containing moieties, which can influence its reactivity and interaction with biological systems. Additionally, the presence of the methyl group on the phenyl ring may enhance its lipophilicity, potentially affecting its bioavailability and interaction with cellular membranes. Overall, this compound's unique structural features contribute to its chemical behavior and potential applications in diverse areas of research and industry.

Formula: C₉H₁₄NS

InChI: InChI=1/C9H13NS/c1-8-2-4-9(5-3-8)11-7-6-10/h2-5H,6-7,10H2,1H3/p+1

2-[(4-Methylphenyl)thio]ethanamine

CAS: 42404-23-9

Formula: C₉H₁₃NS

Molecular weight: 167.2712

Ref: IN-DA00C8UF

2-[(4-Methylphenyl)thio]ethanamine

CAS: 42404-23-9

2-[(4-Methylphenyl)thio]ethanamine

Purity: 95%

Molecular weight: 167.27g/mol

Ref: 54-OR904253