CAS 42409-58-5
:5-bromo-3-methoxypyridin-2-amine
Description:
5-Bromo-3-methoxypyridin-2-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxy group at the 3-position, along with an amino group at the 2-position, contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino and methoxy functional groups, which can engage in hydrogen bonding. It may also display basic properties due to the amino group, allowing it to act as a nucleophile in various chemical reactions. The bromine substituent can serve as a site for further functionalization, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's structure may influence its biological activity, making it of interest in medicinal chemistry research. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H7BrN2O
InChI:InChI=1/C6H7BrN2O/c1-10-5-2-4(7)3-9-6(5)8/h2-3H,1H3,(H2,8,9)
SMILES:COc1cc(cnc1N)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-5-bromo-3-methoxypyridine, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H7BrN2OPurity:96%Molecular weight:203.045-bromo-3-methoxypyridin-2-amine
CAS:Formula:C6H7BrN2OPurity:98%Color and Shape:SolidMolecular weight:203.03662-Amino-5-bromo-3-methoxypyridine
CAS:2-Amino-5-bromo-3-methoxypyridinePurity:97%Color and Shape:SolidMolecular weight:203.04g/mol5-Bromo-3-methoxypyridin-2-amine
CAS:Formula:C6H7BrN2OPurity:95%Color and Shape:SolidMolecular weight:203.039



