CymitQuimica logo

CAS 4241-12-7

:

6-methyl-2-oxo-5-phenyl-1,2-dihydropyridine-3-carbonitrile

Description:
6-Methyl-2-oxo-5-phenyl-1,2-dihydropyridine-3-carbonitrile, with the CAS number 4241-12-7, is a heterocyclic organic compound characterized by its pyridine-like structure. This compound features a dihydropyridine ring, which is a five-membered ring containing nitrogen, and is substituted with a methyl group, a phenyl group, and a carbonitrile functional group. The presence of the carbonitrile group contributes to its reactivity and potential applications in organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows it to participate in various chemical reactions, making it of interest in medicinal chemistry and materials science. Additionally, derivatives of dihydropyridine compounds are often studied for their biological activities, including potential pharmacological effects. Overall, 6-methyl-2-oxo-5-phenyl-1,2-dihydropyridine-3-carbonitrile represents a versatile scaffold for further chemical exploration and development.
Formula:C13H10N2O
InChI:InChI=1/C13H10N2O/c1-9-12(10-5-3-2-4-6-10)7-11(8-14)13(16)15-9/h2-7H,1H3,(H,15,16)
SMILES:Cc1c(cc(C#N)c(n1)O)c1ccccc1
Synonyms:
  • 2-Hydroxy-6-methyl-5-phenylnicotinonitrile
  • 3-Pyridinecarbonitrile, 2-Hydroxy-6-Methyl-5-Phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.