CAS 4244-47-7
:6-Amino-9H-purine-9-propanoic acid
Description:
6-Amino-9H-purine-9-propanoic acid, also known as 6-amino-9-propylpurine, is a purine derivative characterized by its structural features that include an amino group and a propanoic acid side chain attached to the purine ring. This compound is typically a white to off-white solid and is soluble in water and organic solvents, which facilitates its use in various biochemical applications. The presence of the amino group contributes to its basicity, while the propanoic acid moiety can participate in various chemical reactions, making it a versatile building block in organic synthesis. It is often studied for its potential roles in biological systems, particularly in relation to nucleic acid metabolism and as a precursor in the synthesis of other biologically relevant compounds. Additionally, its CAS number, 4244-47-7, allows for easy identification in chemical databases and literature. Overall, this compound is of interest in both research and pharmaceutical contexts due to its structural and functional properties.
Formula:C8H9N5O2
InChI:InChI=1S/C8H9N5O2/c9-7-6-8(11-3-10-7)13(4-12-6)2-1-5(14)15/h3-4H,1-2H2,(H,14,15)(H2,9,10,11)
InChI key:InChIKey=QXAYJKFBMWMARF-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1C=2C(N=C1)=C(N)N=CN2
Synonyms:- 9H-Purine-9-propanoic acid, 6-amino-
- 9H-Purine-9-propionic acid, 6-amino-
- 9-(2-Carboxyethyl)adenine
- 6-Amino-9H-purine-9-propanoic acid
- 3-(6-Amino-9H-purin-9-yl)propionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(6-Amino-9h-purin-9-yl)propanoic acid
CAS:3-(6-Amino-9h-purin-9-yl)propanoic acidFormula:C8H9N5O2Purity:98%Molecular weight:207.196-Amino-9H-purine-9-propanoic acid
CAS:Formula:C8H9N5O2Purity:98%Color and Shape:SolidMolecular weight:207.18946-Amino-9H-purine-9-propanoic acid
CAS:6-Amino-9H-purine-9-propanoic acid is an acid lactam that belongs to the class of dihedral molecules. It is a colorless solid that crystallizes in plates, which have been shown to have a strong affinity for ammonium ions. 6-Amino-9H-purine-9-propanoic acid has been shown to be a substrate for the enzyme purine nucleoside phosphorylase, which catalyzes the phosphorolysis of nucleosides with the release of inorganic phosphate and ribose 5'-phosphate. The molecule can also react with electron radiation to form gamma rays, which may lead to its use as a molecular probe.Formula:C8H9N5O2Purity:Min. 95%Color and Shape:PowderMolecular weight:207.19 g/mol6-Amino-9H-purine-9-propanoic Acid
CAS:Controlled ProductApplications An analogue of Eritadenine (E600100) with hypocholesterolemic activity
References Tensho, A. et al.: Yakug. Zas., 94, 708 (1974);Formula:C8H9N5O2Color and Shape:NeatMolecular weight:207.19





