CAS 42448-56-6: pentamethylbenzenethiol

Description: Pentamethylbenzenethiol, with the CAS number 42448-56-6, is an organosulfur compound characterized by a thiol functional group (-SH) attached to a pentamethyl-substituted benzene ring. This compound features a highly branched structure, which contributes to its unique chemical properties. Pentamethylbenzenethiol is typically a colorless to pale yellow liquid with a strong, distinctive odor, often associated with sulfur-containing compounds. It is relatively insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature due to the bulky methyl groups. The presence of the thiol group imparts reactivity, allowing it to participate in various chemical reactions, such as oxidation to form disulfides or reactions with electrophiles. Additionally, pentamethylbenzenethiol can serve as a ligand in coordination chemistry and may have applications in materials science and organic synthesis. Safety precautions should be taken when handling this compound, as thiols can be toxic and have strong odors that may be irritating.

Formula: C₁₁H₁₆S

InChI: InChI=1/C11H16S/c1-6-7(2)9(4)11(12)10(5)8(6)3/h12H,1-5H3

Pentamethylbenzene-1-thiol

CAS: 42448-56-6

Versatile small molecule scaffold

• Formula: C₁₁H₁₆S
• Purity: Min. 95%
• Molecular weight: 180.31 g/mol

Pentamethylbenzene-1-thiol

CAS: 42448-56-6

• Purity: 95%
• Molecular weight: 180.30999755859375