CAS 42448-56-6
:pentamethylbenzenethiol
Description:
Pentamethylbenzenethiol, with the CAS number 42448-56-6, is an organosulfur compound characterized by a thiol functional group (-SH) attached to a pentamethyl-substituted benzene ring. This compound features a highly branched structure, which contributes to its unique chemical properties. Pentamethylbenzenethiol is typically a colorless to pale yellow liquid with a strong, distinctive odor, often associated with sulfur-containing compounds. It is relatively insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature due to the bulky methyl groups. The presence of the thiol group imparts reactivity, allowing it to participate in various chemical reactions, such as oxidation to form disulfides or reactions with electrophiles. Additionally, pentamethylbenzenethiol can serve as a ligand in coordination chemistry and may have applications in materials science and organic synthesis. Safety precautions should be taken when handling this compound, as thiols can be toxic and have strong odors that may be irritating.
Formula:C11H16S
InChI:InChI=1/C11H16S/c1-6-7(2)9(4)11(12)10(5)8(6)3/h12H,1-5H3
SMILES:Cc1c(C)c(C)c(c(C)c1C)S
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Pentamethylbenzene-1-thiol
CAS:<p>Pentamethylbenzene-1-thiol is a synthetic, sulfide-containing compound. The molecular weight of the compound is 230.07. It has been shown to be an excellent lubricant and has a high sulfur content. Pentamethylbenzene-1-thiol can be used as a surfactant in the synthesis of organic compounds and as an intermediate for fluorinating agents. This compound is soluble in water and other polar solvents and insoluble in nonpolar solvents such as hexane or benzene. Pentamethylbenzene-1-thiol has been shown to react with nitro groups under acidic conditions, which may be useful for synthesizing pentafluorides. The methodologies that are available for this synthesis include methylation, chlorination, hydrolysis, or oxidation with nitrous acid.</p>Formula:C11H16SPurity:Min. 95%Molecular weight:180.31 g/mol
