CymitQuimica logo

CAS 42465-69-0

:

1-(2-Amino-3,4,5-trimethoxyphenyl)ethanone

Description:
1-(2-Amino-3,4,5-trimethoxyphenyl)ethanone, with the CAS number 42465-69-0, is an organic compound characterized by its phenolic structure and the presence of an ethanone functional group. This compound features a phenyl ring substituted with three methoxy groups and an amino group, which contribute to its chemical reactivity and potential biological activity. The methoxy groups enhance the lipophilicity of the molecule, potentially influencing its interaction with biological membranes. The amino group can participate in hydrogen bonding and may play a role in the compound's pharmacological properties. This substance may be of interest in medicinal chemistry due to its structural features, which could be linked to various biological activities, including potential anti-inflammatory or neuroprotective effects. Additionally, its synthesis and characterization may involve standard organic chemistry techniques, including functional group transformations and spectroscopic analysis for confirmation of structure. Overall, 1-(2-Amino-3,4,5-trimethoxyphenyl)ethanone represents a compound with intriguing properties that warrant further investigation in both synthetic and medicinal chemistry contexts.
Formula:C11H15NO4
InChI:InChI=1/C11H15NO4/c1-6(13)7-5-8(14-2)10(15-3)11(16-4)9(7)12/h5H,12H2,1-4H3
SMILES:CC(=O)c1cc(c(c(c1N)OC)OC)OC
Synonyms:
  • 3',4',5'-Trimethoxy-2'-aminoacetophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.