CAS 42471-42-1

1-(2-chloroethyl)-3-(2-pyridin-2-ylethyl)urea

Description:

1-(2-Chloroethyl)-3-(2-pyridin-2-ylethyl)urea, with the CAS number 42471-42-1, is a chemical compound that features a urea functional group substituted with both a chloroethyl and a pyridinyl moiety. This compound typically exhibits characteristics associated with both its urea backbone and the substituents. The presence of the chloroethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions, while the pyridine ring can contribute to the compound's overall polarity and ability to engage in hydrogen bonding. The molecular structure indicates that it may possess biological activity, potentially acting as a pharmacophore in medicinal chemistry. Its solubility is likely influenced by the polar nature of the urea and pyridine groups, while the chloroethyl group may enhance lipophilicity. Overall, this compound's unique structure may lead to interesting interactions in biological systems, making it a subject of interest in drug development and chemical research.

Formula: C₁₀H₁₄ClN₃O

InChI: InChI=1/C10H14ClN3O/c11-5-8-14-10(15)13-7-4-9-3-1-2-6-12-9/h1-3,6H,4-5,7-8H2,(H2,13,14,15)

SMILES: c1ccnc(c1)CCN=C(NCCCl)O

N-(2-Chloroethyl)-N'-[2-(2-pyridinyl)ethyl]urea

CAS: 42471-42-1

Formula: C₁₀H₁₄ClN₃O

Molecular weight: 227.6907

Ref: IN-DA00727X

N-(2-Chloroethyl)-N'-(2-pyridin-2-ylethyl)urea

CAS: 42471-42-1

N-(2-Chloroethyl)-N'-(2-pyridin-2-ylethyl)urea

Purity: ≥95%

Molecular weight: 227.69g/mol

Ref: 54-OR12064