CAS 4249-10-9

1,2,3,4-Tetramethyl-1,3-cyclopentadiene

Description:

1,2,3,4-Tetramethyl-1,3-cyclopentadiene is an organic compound characterized by its unique cyclic structure and multiple methyl substituents. It features a cyclopentadiene framework, which is a five-membered ring containing two double bonds, and is further substituted with four methyl groups at the 1, 2, 3, and 4 positions. This substitution enhances its stability and alters its reactivity compared to unsubstituted cyclopentadiene. The compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its use in organic synthesis and as a ligand in coordination chemistry due to its ability to form stable complexes with transition metals. The presence of multiple methyl groups contributes to its steric hindrance, influencing its chemical behavior and interactions. Additionally, 1,2,3,4-tetramethyl-1,3-cyclopentadiene is relatively nonpolar, which affects its solubility in various solvents. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure.

Formula: C₉H₁₄

InChI: InChI=1/C9H14/c1-6-5-7(2)9(4)8(6)3/h5H2,1-4H3

SMILES: CC1=C(C)C(=C(C)C1)C

Synonyms:

• 1,2,3,4-Tetramethylcyclopentadiene
• 1,2,3,4-Tetramethylcyclopenta-1,3-Diene

1,2,3,4-Tetramethylcyclopenta-1,3-diene

CAS: 4249-10-9

Formula: C₉H₁₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 122.2075

Ref: IN-DA003DAB

1,2,3,4-Tetramethylcyclopenta-1,3-diene

CAS: 4249-10-9

1,2,3,4-Tetramethylcyclopenta-1,3-diene

Purity: 98%,mixture of isomers

Molecular weight: 122.21g/mol

Ref: 54-OR1024846

1,2,3,4-Tetramethylcyclopenta-1,3-diene

CAS: 4249-10-9

Purity: 95% (mixture of isomers)

Molecular weight: 122.2109985

Ref: 10-F862606