CymitQuimica logo

CAS 42497-46-1

:

2,3,4,9-tetrahydro-1H-carbazole-1-carboxylic acid

Description:
2,3,4,9-Tetrahydro-1H-carbazole-1-carboxylic acid is an organic compound characterized by its bicyclic structure, which includes a carbazole moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activities and applications in drug development. Its structure allows for various chemical modifications, which can enhance its pharmacological properties. Additionally, the presence of multiple rings in its structure may influence its stability and reactivity. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2,3,4,9-tetrahydro-1H-carbazole-1-carboxylic acid represents a versatile compound with potential applications in research and industry.
Formula:C13H13NO2
InChI:InChI=1/C13H13NO2/c15-13(16)10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-2,4,7,10,14H,3,5-6H2,(H,15,16)
SMILES:c1ccc2c(c1)c1CCCC(c1[nH]2)C(=O)O
Synonyms:
  • 1H-carbazole-1-carboxylic acid, 2,3,4,9-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.