CAS 425-61-6
:2,2,3,3-Tetrafluoro-1,4-butanediol
Description:
2,2,3,3-Tetrafluoro-1,4-butanediol is a fluorinated organic compound characterized by the presence of four fluorine atoms and two hydroxyl (-OH) groups on a butane backbone. Its molecular structure contributes to its unique properties, including high thermal stability and low volatility, making it suitable for various applications in the chemical industry. The presence of fluorine atoms imparts hydrophobic characteristics, while the hydroxyl groups enhance its solubility in polar solvents. This compound is typically used as an intermediate in the synthesis of fluorinated polymers and other specialty chemicals. Additionally, it exhibits low toxicity and is considered to have a minimal environmental impact, although proper handling and safety measures are recommended due to its chemical reactivity. Its physical properties, such as boiling point and melting point, are influenced by the fluorination and hydroxylation, which can affect its phase behavior and interactions with other substances. Overall, 2,2,3,3-Tetrafluoro-1,4-butanediol is a versatile compound with significant utility in advanced material science and chemical synthesis.
Formula:C4H6F4O2
InChI:InChI=1/C4H6F4O2/c5-3(6,1-9)4(7,8)2-10/h9-10H,1-2H2
SMILES:C(C(C(CO)(F)F)(F)F)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2,3,3-Tetrafluoro-1,4-butanediol
CAS:Formula:C4H6F4O2Purity:>95.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:162.082,2,3,3-Tetrafluoro-1,4-butanediol, 97%
CAS:2,2,3,3-Tetrafluoro-1,4-butanediol is a reactant used for the enzymic synthesis of silicone fluorinated aliphatic polyester amides. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy
Formula:C4H6F4O2Purity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:162.082,2,3,3-Tetrafluorobutane-1,4-diol
CAS:Formula:C4H6F4O2Purity:98%Color and Shape:SolidMolecular weight:162.08292,2,3,3-Tetrafluorobutane-1,4-diol
CAS:2,2,3,3-Tetrafluorobutane-1,4-diolFormula:C4H6F4O2Purity:98%Color and Shape: white crystalline solidMolecular weight:162.08285g/mol2,2,3,3-Tetrafluoro-1,4-butanediol
CAS:Formula:C4H6F4O2Purity:98%Color and Shape:SolidMolecular weight:162.084




