CAS 42508-60-1
:N-Acetonylpyridinium chloride
Description:
N-Acetonylpyridinium chloride is a quaternary ammonium compound characterized by its pyridinium ring structure, which is substituted with an acetonyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its ionic nature. It exhibits properties typical of quaternary ammonium salts, including antimicrobial activity and potential use as a surfactant. The presence of the acetonyl group contributes to its reactivity, making it useful in various chemical syntheses and applications in organic chemistry. Additionally, N-acetonylpyridinium chloride may serve as a catalyst or intermediate in the production of other chemical compounds. Safety data indicates that, like many chemical substances, it should be handled with care, using appropriate personal protective equipment to avoid exposure. Its applications may extend to fields such as pharmaceuticals, agrochemicals, and materials science, where its unique properties can be harnessed for specific purposes.
Formula:C8H10ClNO
InChI:InChI=1/C8H10NO.ClH/c1-8(10)7-9-5-3-2-4-6-9;/h2-6H,7H2,1H3;1H/q+1;/p-1
Synonyms:- 1-(2-Oxopropyl)pyridinium
- Pyridinium, 1-(2-Oxopropyl)-
- 1-(2-Oxopropyl)Pyridinium Chloride
- 1-Acetonylpyridinium Chloride
- 1-Acetonylpyridinium chloride,97%
- n-acetonylpyridinium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Acetonylpyridinium Chloride
CAS:Formula:C8H10ClNOPurity:>99.0%(T)(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:171.62N-Acetonylpyridinium chloride, 97%
CAS:N-Acetonylpyridinium chloride is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU rFormula:C8H10ClNOPurity:97%Color and Shape:Crystals or powder or crystalline powder, Cream to pale brownMolecular weight:171.621-Acetonylpyridinium Chloride
CAS:Formula:C8H10ClNOPurity:98%Color and Shape:SolidMolecular weight:171.62411-(2-Oxopropyl)pyridin-1-ium chloride
CAS:1-(2-Oxopropyl)pyridin-1-ium chloridePurity:98%Molecular weight:171.62g/mol





