CAS 42534-05-4
:(2R)-2-(carbamoylamino)-4-methylpentanoate
Description:
The chemical substance known as (2R)-2-(carbamoylamino)-4-methylpentanoate, with the CAS number 42534-05-4, is an amino acid derivative characterized by its structural features that include a carbamoylamino group and a branched aliphatic chain. This compound is typically classified as a carboxylic acid derivative due to the presence of the pentanoate moiety. Its stereochemistry is defined by the (2R) configuration, indicating that it has a specific spatial arrangement around the chiral center, which can influence its biological activity and interactions. The presence of the carbamoylamino group suggests potential applications in biochemical processes, possibly as a building block in peptide synthesis or as a precursor in pharmaceutical formulations. Additionally, the methyl group at the 4-position contributes to its hydrophobic characteristics, which may affect its solubility and reactivity in various environments. Overall, this compound's unique structure and functional groups make it of interest in both synthetic chemistry and biological research.
Formula:C7H13N2O3
InChI:InChI=1/C7H14N2O3/c1-4(2)3-5(6(10)11)9-7(8)12/h4-5H,3H2,1-2H3,(H,10,11)(H3,8,9,12)/p-1/t5-/m1/s1
SMILES:CC(C)C[C@H](C(=O)[O-])NC(=N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(Carbamoylamino)-4-methylpentanoic acid
CAS:2-(Carbamoylamino)-4-methylpentanoic acid is an enzyme that catalyzes the hydrolysis of l-amino acids. It has a broad substrate specificity and is able to hydrolyze branched-chain and n-substituted l-amino acids, as well as D-amino acids. The active site of this enzyme includes a zinc ion coordinated by four amino acid residues, which are important for the stereoselective catalysis of these reactions. This enzyme also displays stereoselectivity in its reactions with L-amino acids over D-amino acids. The crystal structure of 2-(carbamoylamino)-4-methylpentanoic acid reveals that it belongs to the family of dipeptidases, whose members have a beta barrel fold common to many enzymes in this class.Formula:C7H14N2O3Purity:Min. 95%Molecular weight:174.2 g/mol
