CAS 42537-99-5
:H-Ile-Ile-OH
Description:
The chemical substance known as "H-Ile-Ile-OH," with the CAS number 42537-99-5, is a peptide that consists of two isoleucine amino acids linked together, with a hydroxyl group (-OH) at one end. This compound is classified as a dipeptide, which is a type of molecule formed by the condensation of two amino acids. Isoleucine is one of the essential branched-chain amino acids, playing a crucial role in protein synthesis and metabolic processes. The presence of the hydroxyl group suggests that this compound may exhibit specific solubility characteristics and potential reactivity, particularly in biological systems. Peptides like H-Ile-Ile-OH can be involved in various physiological functions, including acting as signaling molecules or influencing metabolic pathways. Additionally, the structural properties of this dipeptide may affect its stability, bioavailability, and interaction with other biomolecules. Overall, H-Ile-Ile-OH represents a significant area of interest in biochemistry and pharmacology, particularly in the study of peptide-based therapeutics.
Formula:C12H24N2O3
InChI:InChI=1/C12H24N2O3/c1-5-7(3)9(13)11(15)14-10(12(16)17)8(4)6-2/h7-10H,5-6,13H2,1-4H3,(H,14,15)(H,16,17)
SMILES:CCC(C)C(C(=NC(C(C)CC)C(=O)O)O)N
Synonyms:- 2-[(2-Ammonio-3-Methylpentanoyl)Amino]-3-Methylpentanoate
- L-ISOLEUCYL-L-ISOLEUCINE
- L-ILE-L-ILE
- Ile-Ile-OH≥ 98% (HPLC)
- L-Isoleucine, L-isoleucyl-
- (2S,3S)-2-((2S,3S)-2-Amino-3-methylpentanamido)-3-methylpentanoic acid
- H-ILE-ILE-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
H-Ile-Ile-OH
CAS:Contrary to similar non-polar dipeptides as Ile-Leu or Ile-Val, Ile-Ile crystallizes forming hydrophobic columns.Formula:C12H24N2O3Purity:> 99%Color and Shape:White LyophilisateMolecular weight:244.33Ile-Ile-OH
CAS:<p>Ile-Ile-OH is a zwitterion that is the product of an enzyme serine protease. It has been shown to exhibit serine protease activity against corynebacterium, and it can be used for the production of active enzymes such as corynebacterium glutamicum. Ile-Ile-OH is synthesized from serine and hydrochloric acid in a reaction catalyzed by the enzyme serine protease. The rate of this reaction depends on pH and temperature, which causes the conversion of ile-ile to ile-ole at higher temperatures. Ile-Ile-OH exhibits conformational properties that are similar to those found in natural amino acids, which may be due to its zwitterionic nature. This compound also has protonation properties that have been shown to be important for uptake assays in L6 cells.</p>Formula:C12H24N2O3Purity:Min. 95%Molecular weight:244.33 g/mol
