CAS 425379-16-4
:2-bromo-3-fluorobenzonitrile
Description:
2-Bromo-3-fluorobenzonitrile is an aromatic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with a nitrile functional group (-C≡N). This compound features a bromine atom at the second position and a fluorine atom at the third position relative to the nitrile group, which is located at the first position of the benzene ring. The presence of these halogens can influence the compound's reactivity, polarity, and overall chemical behavior. 2-Bromo-3-fluorobenzonitrile is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its nitrile group contributes to its potential applications in organic synthesis and pharmaceuticals, as it can participate in various chemical reactions, including nucleophilic additions and substitutions. Additionally, the compound's unique combination of halogen substituents may impart specific electronic properties, making it of interest in materials science and medicinal chemistry. Safety precautions should be observed when handling this compound due to the presence of halogens, which can be hazardous.
Formula:C7H3BrFN
InChI:InChI=1/C7H3BrFN/c8-7-5(4-10)2-1-3-6(7)9/h1-3H
SMILES:c1cc(C#N)c(c(c1)F)Br
Synonyms:- Benzonitrile, 2-Bromo-3-Fluoro-
- 2-Bromo-3-fluorobenzonitrile99%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-3-fluorobenzonitrile
CAS:Formula:C7H3BrFNPurity:97%Color and Shape:SolidMolecular weight:200.0078Ref: IN-DA003GMT
1g38.00€5g65.00€10g123.00€1kgTo inquire25g159.00€100g531.00€500gTo inquire250mg28.00€2-Bromo-3-fluorobenzonitrile
CAS:2-Bromo-3-fluorobenzonitrileFormula:C7H3BrFNPurity:97%Color and Shape: cream solidMolecular weight:200.01g/mol2-Bromo-3-fluorobenzonitrile
CAS:2-Bromo-3-fluorobenzonitrile is a boronic acid that is used in the synthesis of organic compounds. It is made from aryl boronic acids, aryl chlorides, and chlorides. 2-Bromo-3-fluorobenzonitrile has been shown to be an effective reagent for the synthesis of boronic esters and ethers. This reagent is also used in scaleable transformations involving transition metals.Formula:C7H3BrFNPurity:Min. 95%Color and Shape:PowderMolecular weight:200.01 g/mol2-Bromo-3-fluorobenzonitrile
CAS:Formula:C7H3BrFNPurity:97%Color and Shape:SolidMolecular weight:200.01




