CAS 42538-01-2

L-Isoleucine, N-[N-[(phenylmethoxy)carbonyl]-L-isoleucyl]-

Description:

L-Isoleucine, N-[N-[(phenylmethoxy)carbonyl]-L-isoleucyl]- is a synthetic compound that belongs to the class of amino acid derivatives. It is characterized by the presence of the isoleucine amino acid structure, which is essential for protein synthesis and plays a crucial role in various metabolic processes. The compound features a phenylmethoxycarbonyl group, which enhances its stability and solubility, making it suitable for various biochemical applications. This compound is typically used in peptide synthesis and research related to protein engineering. Its molecular structure includes multiple functional groups that contribute to its reactivity and interaction with biological systems. As a derivative of isoleucine, it retains the essential properties of this branched-chain amino acid, such as hydrophobicity and the ability to participate in hydrophobic interactions within proteins. Overall, L-Isoleucine, N-[N-[(phenylmethoxy)carbonyl]-L-isoleucyl]- is significant in the field of biochemistry and pharmaceutical research, particularly in the development of peptide-based therapeutics.

Formula: C₂₀H₃₀N₂O₅

InChI: InChI=1S/C20H30N2O5/c1-5-13(3)16(18(23)21-17(19(24)25)14(4)6-2)22-20(26)27-12-15-10-8-7-9-11-15/h7-11,13-14,16-17H,5-6,12H2,1-4H3,(H,21,23)(H,22,26)(H,24,25)/t13-,14-,16-,17-/m0/s1

InChI key: InChIKey=QJJULDSUCQXEDB-OTRWWLKZSA-N

SMILES: [C@H](C(N[C@@H]([C@H](CC)C)C(O)=O)=O)(NC(OCC1=CC=CC=C1)=O)[C@H](CC)C

Synonyms:

• <span class="text-smallcaps">L</smallcap>-Isoleucine, N-[N-[(phenylmethoxy)carbonyl]-<smallcap>L</span>-isoleucyl]-
• N-[(benzyloxy)carbonyl]-L-isoleucyl-L-isoleucine
• N-[(benzyloxy)carbonyl]isoleucylisoleucine
• Z-Ile-Ile-OH
• L-Isoleucine, N-[N-[(phenylmethoxy)carbonyl]-L-isoleucyl]-

Z-Ile-Ile-OH

CAS: 42538-01-2

Formula: C₂₀H₃₀N₂O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 378.4626

Ref: IN-DA0071VJ

(2S,3S)-2-((2S,3S)-2-(((Benzyloxy)carbonyl)amino)-3-methylpentanamido)-3-methylpentanoic acid

CAS: 42538-01-2

(2S,3S)-2-((2S,3S)-2-(((Benzyloxy)carbonyl)amino)-3-methylpentanamido)-3-methylpentanoic acid

Purity: 95%

Molecular weight: 378.47g/mol

Ref: 54-OR1073503

(2S,3S)-2-((2S,3S)-2-(((Benzyloxy)carbonyl)amino)-3-methylpentanamido)-3-methylpentanoic acid

CAS: 42538-01-2

Formula: C₂₀H₃₀N₂O₅

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 378.469

Ref: 10-F519606

Z-Ile-Ile

Controlled Product

CAS: 42538-01-2

Applications Z-Ile-Ile (cas# 42538-01-2) is a useful research chemical.

Formula: C₂₀H₃₀N₂O₅

Color and Shape: Neat

Molecular weight: 378.47

Ref: TR-I266818