CAS 4254-17-5
:2-Hydroxy-1-(4-methoxyphenyl)-2-phenylethanone
Description:
2-Hydroxy-1-(4-methoxyphenyl)-2-phenylethanone, also known as a type of chalcone derivative, is an organic compound characterized by its structural features, which include a hydroxyl group and two aromatic rings. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in organic solvents such as ethanol and methanol but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the hydroxyl group contributes to its potential reactivity and ability to participate in hydrogen bonding. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activities, such as antioxidant and anti-inflammatory properties. Additionally, it may serve as a precursor in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-18-13-9-7-12(8-10-13)15(17)14(16)11-5-3-2-4-6-11/h2-10,14,16H,1H3
InChI key:InChIKey=PVSFIFPJPUEHPO-UHFFFAOYSA-N
SMILES:C(C(O)C1=CC=CC=C1)(=O)C2=CC=C(OC)C=C2
Synonyms:- 2-Hydroxy-1-(4-methoxyphenyl)-2-phenylethanone
- 4-Methoxybenzoin
- Ethanone, 2-hydroxy-1-(4-methoxyphenyl)-2-phenyl-
- Benzoin, 4-methoxy-
- Hydroxy(phenyl)methyl 4-methoxyphenyl ketone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Methoxybenzoin
CAS:4-Methoxybenzoin is a building block that can be used as a versatile intermediate. It is a white to light yellow crystalline solid that has been reported as a useful scaffold and high quality research chemical. 4-Methoxybenzoin can be used in the synthesis of complex compounds with diverse applications, such as pharmaceuticals and agrochemicals. It is also an important building block for fine chemicals. This chemical reacts with many other chemicals, forming new compounds that have different properties from those of the reactants.Formula:C15H14O3Purity:Min. 97 Area-%Molecular weight:242.27 g/mol4-Methoxybenzoin
CAS:4-Methoxybenzoin is a phenolic compound that belongs to the carbinols. It is an aromatic hydrocarbon that can be synthesized by heating benzaldehyde with methanol and sodium carbonate in ethanol. 4-Methoxybenzoin is used as a chemical intermediate for the synthesis of other chemicals, such as quinidine, anisole, thiosemicarbazide and hydrochloric acid. 4-Methoxybenzoin has been shown to react with cellulose acetate to form an acidic photodegradation product. This reaction can be suppressed by adding sulfuric acid or sodium sulfite.Formula:C15H14O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:242.27 g/mol
