CAS 4254-31-3
:1H-Inden-2-ol, 2,3-dihydro-, 2-acetate
Description:
1H-Inden-2-ol, 2,3-dihydro-, 2-acetate, with the CAS number 4254-31-3, is an organic compound characterized by its bicyclic structure, which includes an indene framework. This compound features a hydroxyl group (-OH) and an acetate group (-OCOCH3) attached to the indene ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the hydroxyl group makes it a potential candidate for hydrogen bonding, influencing its solubility in polar solvents. The acetate moiety can undergo hydrolysis, releasing acetic acid and regenerating the corresponding alcohol. This compound may be utilized in various chemical reactions, including esterification and as an intermediate in the synthesis of more complex organic molecules. Its properties, such as boiling point, melting point, and density, can vary based on purity and environmental conditions, making it essential to consult specific data sheets for precise information.
Formula:C11H12O2
InChI:InChI=1S/C11H12O2/c1-8(12)13-11-6-9-4-2-3-5-10(9)7-11/h2-5,11H,6-7H2,1H3
InChI key:InChIKey=QIOFUOQHSJNCIX-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1CC=2C(C1)=CC=CC2
Synonyms:- 2-Indanol, acetate
- 2-Acetoxyindan
- 1H-Inden-2-ol, 2,3-dihydro-, acetate
- 1H-Inden-2-ol, 2,3-dihydro-, 2-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

