CAS 4254-67-5

1-[4-(benzyloxy)phenyl]-2-bromoethanone

Description:

1-[4-(Benzyloxy)phenyl]-2-bromoethanone, with the CAS number 4254-67-5, is an organic compound characterized by its unique structural features. It contains a bromine atom attached to an ethanone moiety, which is further substituted with a benzyloxy group and a phenyl ring. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in organic solvents such as dichloromethane and ethanol but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the bromine atom suggests potential reactivity, making it useful in various chemical synthesis applications, particularly in the formation of carbon-carbon bonds. Additionally, the benzyloxy group can serve as a protective group in organic synthesis. The compound's properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, 1-[4-(benzyloxy)phenyl]-2-bromoethanone is a valuable intermediate in organic chemistry, particularly in the synthesis of more complex molecules.

Formula: C₁₅H₁₃BrO₂

InChI: InChI=1/C15H13BrO2/c16-10-15(17)13-6-8-14(9-7-13)18-11-12-4-2-1-3-5-12/h1-9H,10-11H2

SMILES: c1ccc(cc1)COc1ccc(cc1)C(=O)CBr

Synonyms:

• Ethanone, 2-Bromo-1-[4-(Phenylmethoxy)Phenyl]-
• 1-[4-(Benzyloxy)phenyl]-2-bromoethanone

4-(BENZYLOXY)-PHENACYL BROMIDE

CAS: 4254-67-5

Formula: C₁₅H₁₃BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 305.1665

Ref: IN-DA0071V3

1-(4-(Benzyloxy)phenyl)-2-bromoethanone

CAS: 4254-67-5

1-(4-(Benzyloxy)phenyl)-2-bromoethanone

Purity: 97%

Molecular weight: 305.17g/mol

Ref: 54-OR79942

1-(4-(Benzyloxy)phenyl)-2-bromoethanone

CAS: 4254-67-5

Formula: C₁₅H₁₃BrO₂

Purity: 95%

Molecular weight: 305.171

Ref: 10-F241651

1-(4-(Benzyloxy)phenyl)-2-bromoethanone

Controlled Product

CAS: 4254-67-5

Formula: C₁₅H₁₃BrO₂

Color and Shape: Neat

Molecular weight: 305.166

Ref: TR-B288010

1-(4-(Benzyloxy)phenyl)-2-bromoethanone

CAS: 4254-67-5

1-(4-Benzyloxy)phenyl-2-bromoethanone is a carbonylation agent that is used to synthesize alkaloids. This compound is efficient and can be used in the synthesis of rigidin, a tetrasubstituted benzene. It is also used as a reagent for the protection of benzyl groups. The deprotection reaction occurs by using triphosgene or catalytic hydrogenation.

Formula: C₁₅H₁₃BrO₂

Purity: Min. 95%

Molecular weight: 305.17 g/mol

Ref: 3D-EAA25467