CAS 425637-18-9: Sotrastaurin
Description:Sotrastaurin, with the CAS number 425637-18-9, is a synthetic compound that functions primarily as a selective inhibitor of protein kinase C (PKC). It is characterized by its role in modulating immune responses and has been investigated for potential therapeutic applications in various inflammatory and autoimmune diseases. Sotrastaurin exhibits a unique chemical structure that allows it to interact specifically with PKC isoforms, thereby influencing cellular signaling pathways. The compound is typically administered in a pharmaceutical context, and its efficacy and safety profiles are evaluated through clinical trials. As a small molecule, Sotrastaurin is soluble in organic solvents and has a defined pharmacokinetic profile, which includes absorption, distribution, metabolism, and excretion characteristics that are crucial for its therapeutic use. Overall, Sotrastaurin represents a significant advancement in targeted therapies aimed at modulating immune function and offers potential benefits in the treatment of conditions such as psoriasis and transplant rejection.
Formula:C25H22N6O2
InChI:InChI=1S/C25H22N6O2/c1-30-10-12-31(13-11-30)25-27-19-9-5-3-7-16(19)22(28-25)21-20(23(32)29-24(21)33)17-14-26-18-8-4-2-6-15(17)18/h2-9,14,26H,10-13H2,1H3,(H,29,32,33)
InChI key:InChIKey=OAVGBZOFDPFGPJ-UHFFFAOYSA-N
SMILES:O=C1NC(=O)C(C2=CNC=3C=CC=CC32)=C1C=4N=C(N=C5C=CC=CC54)N6CCN(C)CC6
- Synonyms:
- 1H-Pyrrole-2,5-dione, 3-(1H-indol-3-yl)-4-[2-(4-methyl-1-piperazinyl)-4-quinazolinyl]-
- 3-(1H-Indol-3-yl)-4-[2-(4-methyl-1-piperazinyl)-4-quinazolinyl]-1H-pyrrole-2,5-dione
- 3-(1H-Indol-3-yl)-4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione
- Sotrastaurin
