CAS 42565-73-1
:(1R,2R)-2-aminocycloheptanol
Description:
(1R,2R)-2-aminocycloheptanol is a chiral cyclic amine with a hydroxyl group and an amino group attached to a cycloheptane ring. This compound features a seven-membered carbon ring, which contributes to its unique structural properties. The presence of both an amino (-NH2) and a hydroxyl (-OH) functional group makes it a potential candidate for various applications in organic synthesis and medicinal chemistry. The specific stereochemistry indicated by the (1R,2R) designation suggests that the molecule has two chiral centers, which can influence its biological activity and interactions. As a secondary amine, it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound's properties, such as melting point, boiling point, and reactivity, can vary significantly based on its stereochemistry and the presence of functional groups. Overall, (1R,2R)-2-aminocycloheptanol is of interest in the fields of pharmaceuticals and organic chemistry due to its potential as a building block for more complex molecules.
Formula:C7H15NO
InChI:InChI=1/C7H15NO/c8-6-4-2-1-3-5-7(6)9/h6-7,9H,1-5,8H2/t6-,7-/m1/s1
SMILES:C1CC[C@H]([C@@H](CC1)O)N
Synonyms:- cycloheptanol, 2-amino-, (1R,2R)-
- (1R,2R)-2-Aminocycloheptanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
trans-2-Amino-cycloheptanol
CAS:<p>trans-2-Amino-cycloheptanol</p>Purity:≥95%Molecular weight:129.20g/molrac-(1R,2R)-2-Aminocycloheptan-1-ol
CAS:<p>Racemic 2-aminocycloheptanol is an organic compound with a molecular formula of C7H14Cl2NO and a molecular weight of 206.24 g/mol. It is classified as a substituted cycloheptane and has the IUPAC name rac-(1R,2R)-2-aminocycloheptan-1-ol. Racemic 2-aminocycloheptanol can be synthesized by the substitution of chlorine atoms for hydrogen atoms on the benzyl group in benzoic acid. This reaction requires catalytic amounts of sodium hydroxide to hydrolyze the benzoic acid, forming sodium chloride and racemic 2-aminocycloheptanol. Racemic 2-aminocycloheptanol is used in the synthesis of antidepressants such as amitriptyline and nortriptyline. These drugs are believed to have their therapeutic effects through inhibition of norepinephrine reupt</p>Formula:C7H15NOPurity:Min. 95%Molecular weight:129.2 g/mol

