
CAS 425671-29-0
:2-Methyl-2-[4-[3-[1-(4-methylbenzyl)-5-oxo-4,5-dihydro-1H-1,2,4-triazol-3-yl]propyl]phenoxy]propionic acid
Description:
2-Methyl-2-[4-[3-[1-(4-methylbenzyl)-5-oxo-4,5-dihydro-1H-1,2,4-triazol-3-yl]propyl]phenoxy]propionic acid, identified by its CAS number 425671-29-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazole ring and a phenoxy group. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its biological activity, particularly in the context of anti-inflammatory or analgesic properties. Its structure suggests the presence of multiple functional groups, including carboxylic acid, which may contribute to its solubility and reactivity. The presence of the triazole moiety indicates potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's lipophilicity may influence its pharmacokinetic properties, such as absorption and distribution within biological systems. Overall, 2-Methyl-2-[4-[3-[1-(4-methylbenzyl)-5-oxo-4,5-dihydro-1H-1,2,4-triazol-3-yl]propyl]phenoxy]propionic acid represents a noteworthy example of complex organic synthesis with potential therapeutic applications.
Formula:C23H27N3O4
InChI:InChI=1/C23H27N3O4/c1-16-7-9-18(10-8-16)15-26-22(29)24-20(25-26)6-4-5-17-11-13-19(14-12-17)30-23(2,3)21(27)28/h7-14H,4-6,15H2,1-3H3,(H,27,28)(H,24,25,29)
SMILES:Cc1ccc(cc1)Cn1c(=O)nc(CCCc2ccc(cc2)OC(C)(C)C(=O)O)[nH]1
Synonyms:- Ly-674
- Ly-518674
- 2-methyl-2-(4-{3-[1-(4-methylbenzyl)-5-oxo-2,5-dihydro-1H-1,2,4-triazol-3-yl]propyl}phenoxy)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
LY518674
CAS:LY518674 (LY-674) decreases triglycerides and increases HDL-C and is used for the treatment of atherosclerosis.Formula:C23H27N3O4Purity:98.87%Color and Shape:SolidMolecular weight:409.48Ref: TM-T15821
1mg167.00€5mg340.00€10mg505.00€25mg802.00€50mg1,099.00€100mg1,485.00€1mL*10mM (DMSO)376.00€LY518674
CAS:LY518674 is a small-molecule inhibitor of protein tyrosine phosphatase 1B (PTP1B) that has been shown to be effective in animal models of atherosclerosis and insulin resistance. LY518674 binds to the active site of PTP1B and inhibits its activity by binding to the phosphate group of ATP, which is required for the activation of PTP1B. LY518674 has also been shown to increase glucose uptake in skeletal muscle cells. The compound has not been tested in humans yet but it is anticipated that it will have a similar effect on human cells as it does on animal cells. LY518674 may be used as an oral treatment for metabolic disorders such as obesity and diabetes.
Formula:C23H27N3O4Purity:Min. 95%Molecular weight:409.5 g/mol


