CAS 42594-17-2
:Tricyclodecanedimethanol diacrylate
Description:
Tricyclodecanedimethanol diacrylate (CAS 42594-17-2) is a chemical compound characterized by its structure, which includes two acrylate functional groups attached to a tricyclodecanedimethanol backbone. This compound is typically a colorless to pale yellow liquid and is known for its high reactivity due to the presence of the acrylate groups, which can undergo polymerization when exposed to UV light or heat. It is commonly used as a crosslinking agent in the formulation of coatings, adhesives, and sealants, enhancing the mechanical properties and durability of the final products. Additionally, it exhibits good thermal stability and resistance to chemicals, making it suitable for various industrial applications. Tricyclodecanedimethanol diacrylate is also valued for its low volatility and low odor, contributing to safer handling and application processes. As with many acrylate compounds, appropriate safety measures should be taken during handling due to potential skin and eye irritation.
Formula:C18H24O4
InChI:InChI=1/C18H24O4/c1-3-15(19)21-10-18(11-22-16(20)4-2)8-7-14-12-5-6-13(9-12)17(14)18/h3-4,12-14,17H,1-2,5-11H2
Synonyms:- octahydro-1H-4,7-methanoindene-1,5-diyldimethanediyl bisprop-2-enoate
- (Octahydro-4,7-methano-1H-indenediyl)bis(methylene) diacrylate
- 2-Propenoic acid, (octahydro-4,7-methano-1H-indene-1,5(1,6 or 2,5)diyl)bis(methylene) ester
- Bis(acryloyloxymethyl)tricyclo[5.2.1.02,6]decane
- 2-Propenoic acid, 1,1′-[(octahydro-4,7-methano-1H-indene-5,?-diyl)bis(methylene)] ester
- Bis(hydroxymethyl)tricyclo[5.2.1.02,6]decane diacrylate
- SA 1002
- 2-Propenoic acid, (octahydro-4,7-methano-1H-indene-5,?-diyl)bis(methylene) ester
- 2-Propenoic acid, 1,1'-((octahydro-4,7-methano-1H-indene-5,?-diyl)bis(methylene)) ester
- 2-Propenoic acid, (octahydro-4,7-methano-1H-indene-5,?-diyl)bis(methylene) ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tricyclo[5.2.1.02,6]decanedimethanol Diacrylate (mixture of isomers) (stabilized with MEHQ)
CAS:Formula:C18H24O4Purity:>90.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:304.39Tricyclo[5.2.1.0(2,6)]Decanedimethanol Diacrylate
CAS:Tricyclo[5.2.1.0(2,6)]Decanedimethanol DiacrylatePurity:98%,mixture of isomers,stabilized with MEHQ 300-60Molecular weight:304.38g/mol

