![4-[2-(1-ethyl-5-oxo-4,4-diphenylpyrrolidin-3-yl)ethyl]morpholin-3-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F325521-4-2-1-ethyl-5-oxo-44-diphenylpyrrolidin-3-yl-ethyl-morpholin-3-one.webp&w=3840&q=75)
CAS 42595-88-0
:4-[2-(1-ethyl-5-oxo-4,4-diphenylpyrrolidin-3-yl)ethyl]morpholin-3-one
Description:
4-[2-(1-ethyl-5-oxo-4,4-diphenylpyrrolidin-3-yl)ethyl]morpholin-3-one, with the CAS number 42595-88-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a morpholine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential biological activity. Morpholine derivatives are often noted for their solubility in polar solvents and can participate in various chemical reactions due to the presence of functional groups. The presence of the diphenyl and pyrrolidine components suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its mechanism of action and therapeutic potential. Overall, this compound represents a class of molecules that could be explored for various applications, particularly in drug development and chemical synthesis.
Formula:C24H28N2O3
InChI:InChI=1/C24H28N2O3/c1-2-25-17-21(13-14-26-15-16-29-18-22(26)27)24(23(25)28,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,21H,2,13-18H2,1H3
SMILES:CCN1CC(CCN2CCOCC2=O)C(c2ccccc2)(c2ccccc2)C1=O
Synonyms:- 3-Morpholinone, 4-(2-(1-ethyl-5-oxo-4,4-diphenyl-3-pyrrolidinyl)ethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
2-Ketodoxapram-d5
CAS:Formula:C24H23D5N2O3Color and Shape:White To Off-White SolidMolecular weight:397.53
