CAS 42595-90-4
:4-[2-(4-Morpholinyl)ethyl]-3,3-diphenyl-2-pyrrolidinone
Description:
4-[2-(4-Morpholinyl)ethyl]-3,3-diphenyl-2-pyrrolidinone, with the CAS number 42595-90-4, is a chemical compound characterized by its complex structure, which includes a pyrrolidinone ring and a morpholine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and pharmacology. The presence of the morpholine group suggests possible interactions with biological targets, potentially influencing its pharmacokinetic and pharmacodynamic profiles. Additionally, the diphenyl substitution may enhance lipophilicity, affecting its distribution in biological systems. The compound's molecular structure indicates it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Overall, its unique characteristics make it a subject of research, particularly in the development of therapeutic agents or as a chemical intermediate in synthetic applications. However, specific safety and handling guidelines should be followed due to the potential biological activity of the compound.
Formula:C22H26N2O2
InChI:InChI=1S/C22H26N2O2/c25-21-22(18-7-3-1-4-8-18,19-9-5-2-6-10-19)20(17-23-21)11-12-24-13-15-26-16-14-24/h1-10,20H,11-17H2,(H,23,25)
InChI key:InChIKey=HLSQTUFDXLVGBT-UHFFFAOYSA-N
SMILES:C(CN1CCOCC1)C2C(C(=O)NC2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 2-Pyrrolidinone, 4-(2-morpholinoethyl)-3,3-diphenyl-
- AHR 0914
- 4-[2-(4-Morpholinyl)ethyl]-3,3-diphenyl-2-pyrrolidinone
- 2-Pyrrolidinone, 4-[2-(4-morpholinyl)ethyl]-3,3-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AHR-0914
CAS:<p>AHR-0914 is a biochemical.</p>Formula:C22H26N2O2Color and Shape:SolidMolecular weight:350.45
