
CAS 42597-57-9
:Ronifibrate
Description:
Ronifibrate is a chemical compound classified as a fibrate, which is primarily used for its lipid-lowering properties. It is known to activate peroxisome proliferator-activated receptors (PPARs), which play a crucial role in the regulation of fatty acid metabolism and glucose homeostasis. The substance is typically utilized in the treatment of dyslipidemia, helping to reduce triglyceride levels and increase high-density lipoprotein (HDL) cholesterol. Ronifibrate exhibits a moderate solubility in organic solvents and is generally poorly soluble in water, which can influence its bioavailability and pharmacokinetics. Its chemical structure includes a phenoxy group, contributing to its biological activity. As with many fibrates, potential side effects may include gastrointestinal disturbances, liver function alterations, and muscle-related issues. Due to its specific mechanism of action and therapeutic applications, Ronifibrate is often considered in the context of cardiovascular health and metabolic syndrome management. However, as with any medication, it is essential to use it under medical supervision to monitor for efficacy and adverse effects.
Formula:C19H20ClNO5
InChI:InChI=1S/C19H20ClNO5/c1-19(2,26-16-8-6-15(20)7-9-16)18(23)25-12-4-11-24-17(22)14-5-3-10-21-13-14/h3,5-10,13H,4,11-12H2,1-2H3
InChI key:InChIKey=AYJVGKWCGIYEAK-UHFFFAOYSA-N
SMILES:O(C(C(OCCCOC(=O)C=1C=CC=NC1)=O)(C)C)C2=CC=C(Cl)C=C2
Synonyms:- Ronifibrate
- I 612
- 3-Pyridinecarboxylic acid, 3-[2-(4-chlorophenoxy)-2-methyl-1-oxopropoxy]propyl ester
- Cloprane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ronifibrate
CAS:<p>Ronifibrate is a lipid modifying agent with antihyperlipidemic and antiarteriosclerotic activity.</p>Formula:C19H20ClNO5Color and Shape:SolidMolecular weight:377.82
