CAS 42599-90-6
:N5-(Aminoiminomethyl)-N5-hydroxy-L-ornithine
Description:
N5-(Aminoiminomethyl)-N5-hydroxy-L-ornithine, with the CAS number 42599-90-6, is a chemical compound that belongs to the class of amino acids and derivatives. It is characterized by the presence of both amino and hydroxy functional groups, which contribute to its reactivity and potential biological activity. This compound is a derivative of L-ornithine, an important amino acid involved in the urea cycle and various metabolic processes. The aminoiminomethyl group introduces additional functional complexity, potentially influencing its interactions with biological systems. N5-(Aminoiminomethyl)-N5-hydroxy-L-ornithine may exhibit properties such as being a substrate or inhibitor in enzymatic reactions, and it could play a role in the synthesis of other bioactive molecules. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting metabolic disorders or other physiological processes. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C6H14N4O3
InChI:InChI=1/C6H14N4O3/c7-4(5(11)12)2-1-3-10(13)6(8)9/h4,13H,1-3,7H2,(H3,8,9)(H,11,12)/t4-/m0/s1
InChI key:InChIKey=KWDSFGYQALRPMG-BYPYZUCNSA-N
SMILES:[C@@H](C(O)=O)(CCCN(C(=N)N)O)N
Synonyms:- Nε-Hydroxyarginine
- N5-(Aminoiminomethyl)-N5-hydroxy-L-ornithine
- N5-Hydroxy-L-arginine
- L-Ornithine, N5-(aminoiminomethyl)-N5-hydroxy-
- N(5)-hydroxy-L-arginine
- N(delta)-hydroxy-L-arginine
- δ-N-Hydroxy-L-arginine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
